6335-90-6 Usage
General Description
[1,3]DIOXOLO[4,5-G]QUINOLIN-6-OL is a chemical compound with a complex and unique structure. It contains a dioxolane ring fused to a quinoline ring, with hydroxyl and carbonyl groups attached to the quinoline ring. [1,3]DIOXOLO[4,5-G]QUINOLIN-6-OL has potential applications in medicinal chemistry and drug discovery due to its interesting structural features. The dioxolane ring may confer unique properties that could be exploited for various purposes, such as drug design and development. Further research and exploration of this compound's chemical and biological properties may reveal its potential for therapeutic use or other applications in the future.
Check Digit Verification of cas no
The CAS Registry Mumber 6335-90-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,3 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6335-90:
(6*6)+(5*3)+(4*3)+(3*5)+(2*9)+(1*0)=96
96 % 10 = 6
So 6335-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO3/c12-10-2-1-6-3-8-9(14-5-13-8)4-7(6)11-10/h1-4H,5H2,(H,11,12)
