6338-22-3 Usage
Uses
Used in Organic Synthesis:
7-chloro-8-methyl-2-phenylquinoline-4-carbonyl chloride is used as a key intermediate in the production of pharmaceuticals, pesticides, and other biologically active compounds. Its unique structure and functional groups make it a valuable building block for the synthesis of heterocyclic molecules and a reagent in chemical research.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 7-chloro-8-methyl-2-phenylquinoline-4-carbonyl chloride is used as a precursor for the synthesis of various drugs. Its ability to form heterocyclic compounds contributes to the development of new medicinal agents with potential therapeutic applications.
Used in Pesticide Industry:
7-chloro-8-methyl-2-phenylquinoline-4-carbonyl chloride is also used in the pesticide industry as a starting material for the synthesis of bioactive compounds with insecticidal, herbicidal, or fungicidal properties. Its versatility allows for the creation of novel pesticides with improved efficacy and selectivity.
Used in Chemical Research:
As a reagent in chemical research, 7-chloro-8-methyl-2-phenylquinoline-4-carbonyl chloride is employed in various experimental procedures to study its chemical properties, reactivity, and potential applications in the synthesis of new compounds.
Overall, 7-chloro-8-methyl-2-phenylquinoline-4-carbonyl chloride is a multifaceted compound with applications in organic synthesis, pharmaceuticals, pesticides, and chemical research, showcasing its importance in the fields of chemistry and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 6338-22-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,3 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6338-22:
(6*6)+(5*3)+(4*3)+(3*8)+(2*2)+(1*2)=93
93 % 10 = 3
So 6338-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H11Cl2NO/c1-10-14(18)8-7-12-13(17(19)21)9-15(20-16(10)12)11-5-3-2-4-6-11/h2-9H,1H3
