6341-57-7 Usage
Derivative of malonic acid
2-(1-Naphthyl)malonic acid is derived from malonic acid, which means it has a similar structure with modifications.
1-Naphthyl group attachment
A 1-naphthyl group is attached to the carbon atom at position 2, giving the compound its unique properties.
Building block in organic synthesis
2-(1-Naphthyl)malonic acid is commonly used as a building block for creating various functionalized molecules in organic synthesis and research.
Versatile reactivity
This compound is known for its ability to undergo reactions such as esterification, oxidation, and reduction, making it a valuable tool in the development of new compounds.
Synthesis of complex organic molecules
The unique structure of 2-(1-Naphthyl)malonic acid allows for the synthesis of a wide range of complex organic molecules.
Importance in organic chemistry
2-(1-Naphthyl)malonic acid is an important and valuable chemical in the field of organic chemistry due to its versatile reactivity and ability to form complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 6341-57-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6341-57:
(6*6)+(5*3)+(4*4)+(3*1)+(2*5)+(1*7)=87
87 % 10 = 7
So 6341-57-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H10O4/c14-12(15)11(13(16)17)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H,(H,14,15)(H,16,17)
