6342-21-8 Usage
Uses
Used in Pharmaceutical Industry:
(2-AMINO-1-PHENYLETHYL)DIMETHYLAMINE is used as a reagent in organic synthesis for the production of pharmaceuticals. Its unique structure allows it to participate in a range of chemical reactions, facilitating the creation of diverse medicinal compounds.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, (2-AMINO-1-PHENYLETHYL)DIMETHYLAMINE serves as a reagent in organic synthesis, contributing to the development of various agrochemical products designed to enhance crop protection and yield.
Used as a Precursor in Organic Synthesis:
(2-AMINO-1-PHENYLETHYL)DIMETHYLAMINE is utilized as a precursor in the synthesis of a variety of organic compounds. Its presence in the molecular structure of these compounds can influence their properties and potential applications.
It is crucial to handle (2-AMINO-1-PHENYLETHYL)DIMETHYLAMINE with care due to its potential health and safety risks if not used properly, highlighting the need for proper safety measures during its application in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6342-21-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 2 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6342-21:
(6*6)+(5*3)+(4*4)+(3*2)+(2*2)+(1*1)=78
78 % 10 = 8
So 6342-21-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2/c1-12(2)10(8-11)9-6-4-3-5-7-9/h3-7,10H,8,11H2,1-2H3
