63512-52-7 Usage
Type of compound
Quaternary ammonium salt
Core structure
Pyridinium
Substituents
Ethyl group, phenylthio moiety
Uses
Organic synthesis, phase transfer catalyst
Potential applications
Medicinal chemistry (anti-inflammatory or antifungal agent), biocidal properties (bactericide)
Unique features
Versatile and valuable in chemistry and biological sciences
Check Digit Verification of cas no
The CAS Registry Mumber 63512-52-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,5,1 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 63512-52:
(7*6)+(6*3)+(5*5)+(4*1)+(3*2)+(2*5)+(1*2)=107
107 % 10 = 7
So 63512-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H14NS.HI/c1-2-14-10-8-13(9-11-14)15-12-6-4-3-5-7-12;/h3-11H,2H2,1H3;1H/q+1;/p-1
