63589-18-4 Usage
Uses
Used in Organic Synthesis:
Benzonitrile, 2-hydrazino(9CI) is used as a key intermediate in the synthesis of complex organic compounds. Its unique structure allows it to undergo multiple chemical reactions, facilitating the creation of a wide range of products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Benzonitrile, 2-hydrazino(9CI) serves as a building block for the development of various drugs. Its potential pharmacological properties, including antiviral and antibacterial activities, make it a valuable component in the formulation of new medications.
Used in Agrochemical Industry:
Benzonitrile, 2-hydrazino(9CI) is utilized in the agrochemical sector for the production of pesticides and other agricultural chemicals. Its chemical properties enable it to be incorporated into compounds that can effectively control pests and diseases in crops.
Used in Dye Industry:
In the dye industry, Benzonitrile, 2-hydrazino(9CI) is employed in the synthesis of various dyes. Its ability to form different chemical structures allows it to contribute to the creation of a diverse range of colorants used in textiles, plastics, and other applications.
Used in Research and Development:
Benzonitrile, 2-hydrazino(9CI) is also used in research and development settings to explore its potential applications and properties further. Its unique structure and reactivity make it an interesting subject for scientific investigations, which may lead to the discovery of new uses and applications.
It is crucial to follow proper handling and safety measures when working with Benzonitrile, 2-hydrazino(9CI) due to its potential health hazards and toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 63589-18-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,5,8 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 63589-18:
(7*6)+(6*3)+(5*5)+(4*8)+(3*9)+(2*1)+(1*8)=154
154 % 10 = 4
So 63589-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3/c8-5-6-3-1-2-4-7(6)10-9/h1-4,10H,9H2
63589-18-4Relevant academic research and scientific papers
Process for producing 3-anilino-5-pyrazolones
-
, (2008/06/13)
A process for producing a 3-anilino-5-pyrazolone which comprises reacting a β-anilino-β-alkoxy-acrylate with a hydrazine in the presence of a compound having a pKa of about 8 up to about 14.
