63689-64-5 Usage
Uses
Used in Analytical Chemistry:
2,6-DIKETO-4-THIA-18-CROWN-6 is used as a component in ion-selective electrodes for the detection of metal ions in solution. Its selective binding to metal ions allows for accurate and sensitive measurements of metal ion concentrations in various samples.
Used in Chemical and Biological Processes:
2,6-DIKETO-4-THIA-18-CROWN-6 is used as a chelating agent in chemical and biological processes. Its ability to selectively bind metal ions can help control the reactivity and stability of metal-containing compounds, making it useful in various chemical reactions and biological systems.
Used in Pharmaceutical Industry:
2,6-DIKETO-4-THIA-18-CROWN-6 is used as a carrier or stabilizer for metal-based drugs. Its metal ion recognition properties can enhance the solubility, bioavailability, and therapeutic efficacy of metal-containing pharmaceuticals.
Used in Environmental Applications:
2,6-DIKETO-4-THIA-18-CROWN-6 is used for the selective removal or recovery of metal ions from contaminated water or soil. Its selective binding to metal ions can help in the efficient and targeted remediation of metal pollution in the environment.
Used in Material Science:
2,6-DIKETO-4-THIA-18-CROWN-6 is used in the development of metal-organic frameworks (MOFs) and other advanced materials with specific properties. Its ability to selectively bind metal ions can contribute to the design and synthesis of materials with tailored characteristics for various applications, such as gas storage, catalysis, or sensing.
Check Digit Verification of cas no
The CAS Registry Mumber 63689-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,8 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 63689-64:
(7*6)+(6*3)+(5*6)+(4*8)+(3*9)+(2*6)+(1*4)=165
165 % 10 = 5
So 63689-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H20O7S/c13-11-9-20-10-12(14)19-8-6-17-4-2-15-1-3-16-5-7-18-11/h1-10H2
63689-64-5Relevant academic research and scientific papers
The Preparation of Macrocyclic Polyether-Diester Compounds by Transesterification Including The Preparation of Two New Nitrogen Containing Diester-Crown Compounds
Bradshaw, Jerald S.,Jones, Brian A.,Nielsen, Ralph B.,Spencer, Neil O.,Thompson, Patricia K.
, p. 957 - 962 (2007/10/02)
Macrocyclic polyether-diester compounds have been prepared by reacting oligoethylene glycols with the appropriate dimethyl esters in the presence of catalytic amounts of alkali metal methoxides.The methanol by-product was removed by molecular sieves.Product yields were improved for the preparation of all macrocyclic compounds except a compound containing a furan subcyclic group (4).Six new macrocyclic diester compounds (7-12) could only be prepared using the base catalyzed transesterification process since the acid chloride synthetic method failed or the acid chloride could not be made.The formation of compounds 5 and 6 from dimethyl 2,6-pyridine dicarboxylate (17) and the triethylene and tetraethylene glycols proceeded by way of half-transesterified intermediates.These intermediates were also observed for the base catalyzed decomposition of 5 and 6 in methanol to form the glycol and the diester 17.
