63689-64-5 Usage
General Description
2,6-DIKETO-4-THIA-18-CROWN-6, also known as dithia-18-crown-6, is a chemical compound belonging to the family of crown ethers. These compounds are characterized by a ring structure containing several oxygen, sulfur, and/or nitrogen atoms, which can selectively bind metal ions. 2,6-DIKETO-4-THIA-18-CROWN-6 has a specific sulfur-containing crown ether ring, which allows it to selectively bind to certain metal ions, such as sodium, potassium, and cesium, in a process known as metal ion recognition. This property has made it useful in various fields, including as a component in ion-selective electrodes for the detection of metal ions in solution, or as a chelating agent in chemical or biological processes. Its unique structure and metal ion recognition properties make 2,6-DIKETO-4-THIA-18-CROWN-6 a valuable chemical in various scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 63689-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,8 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 63689-64:
(7*6)+(6*3)+(5*6)+(4*8)+(3*9)+(2*6)+(1*4)=165
165 % 10 = 5
So 63689-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H20O7S/c13-11-9-20-10-12(14)19-8-6-17-4-2-15-1-3-16-5-7-18-11/h1-10H2
