6375-61-7 Usage
Uses
Used in Pharmaceutical Industry:
[(4-chloro-2-nitrophenyl)thio]acetic acid is used as a building block for the development of new drugs due to its distinctive chemical properties. Its ability to form various interactions with biological targets makes it a promising candidate for the creation of novel therapeutic agents.
Used in Agricultural Industry:
In the agricultural sector, [(4-chloro-2-nitrophenyl)thio]acetic acid is utilized as a precursor in the synthesis of pesticides. Its chemical structure allows for the development of compounds with potent pesticidal activity, contributing to more effective crop protection strategies.
Used in Organic Synthesis:
[(4-chloro-2-nitrophenyl)thio]acetic acid serves as a versatile reagent in the synthesis of other organic compounds. Its unique functional groups facilitate a range of chemical reactions, enabling the creation of diverse molecules with potential applications in various industries.
Used in Chemical Research:
As a synthetic organosulfur compound, [(4-chloro-2-nitrophenyl)thio]acetic acid holds potential for future industrial and research applications. Ongoing studies aim to further explore its properties and possible uses, which may lead to new discoveries and innovations in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6375-61-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,7 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6375-61:
(6*6)+(5*3)+(4*7)+(3*5)+(2*6)+(1*1)=107
107 % 10 = 7
So 6375-61-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClNO4S/c9-5-1-2-7(15-4-8(11)12)6(3-5)10(13)14/h1-3H,4H2,(H,11,12)