6380-95-6 Usage
Uses
Used in Organic Synthesis:
2-methoxybut-2-ene is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the production of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Chemical Reactions as a Reagent:
As a reagent, 2-methoxybut-2-ene is employed in a wide range of chemical reactions to facilitate the formation of desired products. Its reactivity and functional groups enable it to participate in various reaction mechanisms, such as nucleophilic addition, elimination, and substitution reactions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-methoxybut-2-ene is used as a starting material for the synthesis of various drug molecules. Its ability to undergo a variety of chemical transformations makes it an essential component in the development of new medications and therapeutic agents.
Used in Agrochemical Industry:
2-methoxybut-2-ene is also utilized in the agrochemical industry for the synthesis of active ingredients in pesticides and herbicides. Its versatility in chemical reactions allows for the creation of novel compounds with improved efficacy and selectivity.
Used in Specialty Chemicals Production:
In the production of specialty chemicals, 2-methoxybut-2-ene serves as a crucial precursor for the synthesis of various high-value compounds. Its unique properties and reactivity contribute to the development of innovative materials with specific applications in industries such as coatings, adhesives, and polymers.
Check Digit Verification of cas no
The CAS Registry Mumber 6380-95-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,8 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6380-95:
(6*6)+(5*3)+(4*8)+(3*0)+(2*9)+(1*5)=106
106 % 10 = 6
So 6380-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H10O/c1-4-5(2)6-3/h4H,1-3H3/b5-4-
