6396-93-6 Usage
Uses
Due to the limited information available on 3-Methyl-1-phenethylbutylamine, its specific applications are not well-documented. However, based on the general properties of amines, we can infer potential uses in various industries:
Used in Chemical Synthesis:
3-Methyl-1-phenethylbutylamine is used as a building block for the synthesis of more complex organic compounds, given its amine functional group and unique structural features.
Used in Pharmaceutical Industry:
3-Methyl-1-phenethylbutylamine is used as an intermediate in the production of pharmaceuticals, potentially contributing to the development of new drugs due to its unique molecular structure.
Used in Research and Development:
3-Methyl-1-phenethylbutylamine is used as a research compound for studying the properties and reactivity of amines, which can lead to a better understanding of their potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6396-93-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,9 and 6 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6396-93:
(6*6)+(5*3)+(4*9)+(3*6)+(2*9)+(1*3)=126
126 % 10 = 6
So 6396-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H21N/c1-11(2)10-13(14)9-8-12-6-4-3-5-7-12/h3-7,11,13H,8-10,14H2,1-2H3
