6396-93-6 Usage
General Description
3-Methyl-1-phenethylbutylamine is a complex organic compound that falls under the classification of amines. As the name indicates, it comprises a butylamine core with a 3-methyl and 1-phenethyl substitution. However, there's scarce information available regarding its specific properties or uses. Amines like 3-Methyl-1-phenethylbutylamine are typically characterized by their nitrogen atom that has a lone pair of electrons; thus they often act as bases in chemical reactions. Their properties and applications can significantly vary depending on their molecular structure and the presence of other functional groups. As per the universally accepted nomenclature of chemistry, its systematic name would be 1-(2-phenylethyl)-3-methylbutan-1-amine.
Check Digit Verification of cas no
The CAS Registry Mumber 6396-93-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,9 and 6 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6396-93:
(6*6)+(5*3)+(4*9)+(3*6)+(2*9)+(1*3)=126
126 % 10 = 6
So 6396-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H21N/c1-11(2)10-13(14)9-8-12-6-4-3-5-7-12/h3-7,11,13H,8-10,14H2,1-2H3
