64037-13-4 Usage
Uses
Used in Pharmaceutical Research:
5-Iodo-2-benzoxazolamine is used as a building block for the synthesis of various derivatives, which can be further developed into potential drug candidates. Its unique structure and properties make it a valuable component in the discovery of new therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 5-Iodo-2-benzoxazolamine serves as a versatile intermediate for the preparation of biologically active molecules. Its reactivity and functional groups allow for a wide range of chemical transformations, facilitating the synthesis of complex organic compounds.
Used in Materials Science:
5-Iodo-2-benzoxazolamine has been studied for its potential applications in materials science, where its unique properties may contribute to the development of novel materials with specific characteristics, such as improved stability or enhanced performance in various applications.
Used as a Fluorescent Probe in Biological Systems:
5-Iodo-2-benzoxazolamine has been explored as a fluorescent probe for detecting specific molecules in biological systems. Its fluorescent properties allow for the visualization and tracking of target molecules, providing valuable insights into biological processes and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 64037-13-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,3 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 64037-13:
(7*6)+(6*4)+(5*0)+(4*3)+(3*7)+(2*1)+(1*3)=104
104 % 10 = 4
So 64037-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5IN2O/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H,(H2,9,10)
64037-13-4Relevant academic research and scientific papers
MTOR INHIBITOR COMPOUNDS
-
Paragraph 0161, (2020/11/24)
The invention relates to novel mTOR inhibitor compounds. The invention is characterized in that the mTOR inhibitor compounds have general formula (I). The invention also relates to compositions comprising said mTOR inhibitor compounds, methods for produci
