64038-57-9 Usage
Uses
Used in Pharmaceutical Industry:
2,3-dihydro-3-methyl-2-thioxo-1H-imidazole-4-carboxylic acid is used as a pharmaceutical agent for its potential antimicrobial or antifungal properties. Its imidazole and carboxylic acid functional groups contribute to its bioactivity, making it a valuable compound for the development of new drugs with improved therapeutic potential.
Used in Medicinal Chemistry Research:
2,3-dihydro-3-methyl-2-thioxo-1H-imidazole-4-carboxylic acid serves as a key intermediate in the synthesis of various drug candidates. Its unique structural features and potential biological activities make it an attractive target for medicinal chemists and pharmaceutical researchers to explore and develop new drugs with enhanced bioactivity and therapeutic efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 64038-57-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,3 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 64038-57:
(7*6)+(6*4)+(5*0)+(4*3)+(3*8)+(2*5)+(1*7)=119
119 % 10 = 9
So 64038-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2S/c1-7-3(4(8)9)2-6-5(7)10/h2H,1H3,(H,6,10)(H,8,9)
64038-57-9Relevant academic research and scientific papers
Palma, Elisa,Correia, Joao D. G.,Domingos, Angela,Santos, Isabel
, p. 2402 - 2407 (2002)
The preparation of the mixed-ligand ReV complexes [Re(O)(κ3-SSS)(κ1-Simz)] (1), [Re(O)(κ3-SSS)(κ1-Simz)]·HCl (2) and [Re(O)(κ3-SSS)(κ1-SimzCOGlyGly)] (3) are described. These [3+1] type compounds are stabilized by tridentate bis(2-mercaptoethyl) sulfide (HSSSH) and by monodentate functionalized thioimidazolyl ligands. Complexes 1, 2 and 3 were fully characterized by IR and 1H NMR spectroscopy, and by X-ray diffraction analysis in the case of 1 and 2. In complexes 1 and 2 the Re atom is five-coordinate, presenting a distorted square pyramidal coordination geometry. Based on the angular structural parameter, τ, this distortion lies towards a trigonal bipyramidal geometry (τ = 0.40, 1; τ = 0.46, 2). Wiley-VCH Verlag GmbH, 69451 Weinheim, Germany, 2002.
