64038-58-0 Usage
Chemical class
Thiol-containing heterocycles
Structure
Sulfur-containing derivative of imidazole with a cyclohexyl group attached to the 1-position and a thiol (-SH) group at the 2-position
Applications
a. Synthesis of pharmaceuticals and agrochemicals
b. Various industrial applications
c. Building block in organic synthesis
d. Ligand in coordination chemistry
e. Development of novel polymers and nanomaterials in materials science
Versatility
Unique structure allows for a wide range of potential applications
Chemical reactivity
Useful in a variety of chemical reactions due to its thiol and imidazole functional groups
Coordination chemistry
Can act as a ligand, forming complexes with metal ions
Potential for materials science
Its properties make it a promising candidate for the development of new materials, such as polymers and nanomaterials, with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 64038-58-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,3 and 8 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 64038-58:
(7*6)+(6*4)+(5*0)+(4*3)+(3*8)+(2*5)+(1*8)=120
120 % 10 = 0
So 64038-58-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2S/c12-9-10-6-7-11(9)8-4-2-1-3-5-8/h6-8H,1-5H2,(H,10,12)
64038-58-0Relevant academic research and scientific papers
One-pot preparation of 1-substituted imidazole-2-thione from isothiocyanate and amino acetal
Matsuda, Koyo,Yanagisawa, Isao,Isomura, Yasuo,Mase, Toshiyasu,Shibanuma, Tadao
, p. 3565 - 3571 (2007/10/03)
Isothiocyanates were treated with amino acetal and cone. HCl (0.5 eq.) successively in one-pot to afford 1-substituted imidazole-2-thiones in good yields.
