64189-08-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-4-pyridinecarboxylic acid hydrazide is used as a reagent for the preparation of pyrazole containing compounds, which are important in the development of various pharmaceuticals.
Used in Antitubercular Agent Development:
3-Amino-4-pyridinecarboxylic acid hydrazide is used as a building block in the synthesis of antitubercular agents, contributing to the development of new treatments for tuberculosis.
Used in Medicinal Chemistry:
3-Amino-4-pyridinecarboxylic acid hydrazide is used as a versatile building block for the synthesis of heterocyclic compounds and bioactive molecules, playing a crucial role in the discovery and development of novel therapeutic agents.
Used in Organic Chemistry:
3-Amino-4-pyridinecarboxylic acid hydrazide is used as a key intermediate in the synthesis of various organic compounds, facilitating the creation of new chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 64189-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,1,8 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 64189-08:
(7*6)+(6*4)+(5*1)+(4*8)+(3*9)+(2*0)+(1*8)=138
138 % 10 = 8
So 64189-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4O/c7-5-3-9-2-1-4(5)6(11)10-8/h1-3H,7-8H2,(H,10,11)
