64295-04-1 Usage
Explanation
The compound is composed of 24 carbon atoms, 30 hydrogen atoms, and 6 nitrogen atoms.
Explanation
The core structure is a six-membered heterocyclic ring containing three nitrogen atoms, with each nitrogen atom bonded to a 1-azetidinyl group.
3. Heterocyclic compound
Explanation
It contains atoms of different elements (carbon, hydrogen, and nitrogen) in its ring structure.
4. Derivative of the triazine group
Explanation
It is derived from the triazine group, which is a six-membered heterocyclic ring containing three nitrogen atoms.
5. Building block in organic synthesis
Explanation
The compound is used as a starting material or intermediate in the synthesis of more complex organic molecules.
6. Potential applications in pharmaceuticals and materials science
Explanation
Due to its unique structure and properties, it may be used in the development of new drugs or materials with specific characteristics.
7. Reactivity and properties of interest in research and industrial processes
Explanation
The compound's reactivity and properties make it a valuable subject for study and application in various fields, such as chemical research and industrial production.
8. Chemical stability
Explanation
The compound is likely to be stable under normal conditions, as it is used as a building block in organic synthesis.
9. Solubility
Explanation
The solubility of the compound may vary depending on the solvent used, but it is likely to be soluble in organic solvents due to its nonpolar nature.
10. Melting or boiling point
Explanation
The specific melting or boiling point of the compound is not provided, but it can be inferred that it would have a relatively high melting or boiling point due to the presence of multiple covalent bonds and the size of the molecule.
Structure
1,3,5-Triazine ring with three 1-azetidinyl groups attached
Check Digit Verification of cas no
The CAS Registry Mumber 64295-04-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,2,9 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 64295-04:
(7*6)+(6*4)+(5*2)+(4*9)+(3*5)+(2*0)+(1*4)=131
131 % 10 = 1
So 64295-04-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N6/c1-4-16(5-1)10-13-11(17-6-2-7-17)15-12(14-10)18-8-3-9-18/h1-9H2
