64334-41-4 Usage
Uses
Used in Polymer and Resin Production:
2,6-Benzothiazolediamine,N6,N6-dimethyl-(9CI) is used as a chemical intermediate for the synthesis of various polymers and resins. Its unique structure and properties contribute to the development of materials with specific characteristics, such as enhanced durability, stability, and performance.
Used as a Rubber Vulcanization Accelerator:
In the rubber industry, 2,6-Benzothiazolediamine,N6,N6-dimethyl-(9CI) serves as a vulcanization accelerator, which helps in the cross-linking process of rubber molecules. This accelerates the vulcanization process, leading to improved rubber properties such as strength, elasticity, and resistance to wear and tear.
Used in Cancer Research:
2,6-Benzothiazolediamine,N6,N6-dimethyl-(9CI) has shown potential biological activity, particularly in the field of cancer research. Its unique chemical structure may contribute to the development of new therapeutic agents or drug candidates for the treatment of various types of cancer. However, further research is required to fully understand its potential applications and risks in this field.
Check Digit Verification of cas no
The CAS Registry Mumber 64334-41-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,3,3 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 64334-41:
(7*6)+(6*4)+(5*3)+(4*3)+(3*4)+(2*4)+(1*1)=114
114 % 10 = 4
So 64334-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N3S/c1-12(2)6-3-4-7-8(5-6)13-9(10)11-7/h3-5H,1-2H3,(H2,10,11)
