6435-75-2 Usage
Uses
Used in Pharmaceutical Industry:
4,5,6,7-TETRAHYDRO-2-BENZOTHIOPHENE-1-CARBOXYLIC ACID is used as a building block for the synthesis of various drugs and active pharmaceutical ingredients. Its potential therapeutic applications are attributed to its structural similarity to other biologically active compounds, making it a valuable component in the development of new medications.
Used in Agrochemicals Industry:
4,5,6,7-TETRAHYDRO-2-BENZOTHIOPHENE-1-CARBOXYLIC ACID may have potential applications in the agrochemicals industry, where its unique structure and properties could be utilized in the development of new agrochemical products.
Used in Dyes Industry:
4,5,6,7-TETRAHYDRO-2-BENZOTHIOPHENE-1-CARBOXYLIC ACID may also find use in the dyes industry, where its chemical properties could contribute to the creation of novel dye formulations.
Used in Specialty Chemicals Industry:
Additionally, the compound has potential applications in other specialty chemical industries, where its versatility and chemical reactivity can be harnessed for the synthesis of various specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 6435-75-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,3 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6435-75:
(6*6)+(5*4)+(4*3)+(3*5)+(2*7)+(1*5)=102
102 % 10 = 2
So 6435-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H15ClO5/c1-3-17-11-6-9(7-15)5-10(14)13(11)19-8-12(16)18-4-2/h5-7H,3-4,8H2,1-2H3
