647020-70-0 Usage
Uses
Used in Pharmaceutical Industry:
Methyl 2-chloro-3-fluorobenzoate is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, Methyl 2-chloro-3-fluorobenzoate serves as a building block for the creation of new pesticides and herbicides. Its chemical properties enable the design of effective compounds that can protect crops and control pests.
Used in Organic Synthesis:
Methyl 2-chloro-3-fluorobenzoate is utilized as a versatile building block in organic synthesis for the construction of more complex molecules. Its reactivity and functional groups make it suitable for various chemical reactions, contributing to the synthesis of a wide range of organic compounds.
Used in Chemical Production:
As an intermediate in the production of various chemicals, Methyl 2-chloro-3-fluorobenzoate plays a crucial role in the chemical industry. Its involvement in the synthesis of different chemical products highlights its importance in the field of organic chemistry.
Used in Consumer Products:
Methyl 2-chloro-3-fluorobenzoate can be found in some consumer products, where it may contribute to the product's properties or serve as a component in the manufacturing process. Its presence in these products underscores its diverse applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 647020-70-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,4,7,0,2 and 0 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 647020-70:
(8*6)+(7*4)+(6*7)+(5*0)+(4*2)+(3*0)+(2*7)+(1*0)=140
140 % 10 = 0
So 647020-70-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClFO2/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4H,1H3
647020-70-0Relevant academic research and scientific papers
COMPOUNDS, COMPOSITIONS AND METHODS OF USE
-
Page/Page column 135-136, (2020/07/06)
Herein, compounds, compositions and methods for modulating inclusion formation and stress granules in cells related to the onset of neurodegenerative diseases, musculoskeletal diseases, cancer, ophthalmological diseases, and viral infections are described.
