64837-49-6 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 5-chloro-1,3,4-thiadiazole-2-carboxylate is used as a synthetic intermediate for the development of pharmaceutical compounds. Its unique structure and functional groups enable the creation of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, Ethyl 5-chloro-1,3,4-thiadiazole-2-carboxylate serves as a key building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its properties allow for the development of effective and targeted agricultural products.
Used in Materials Science:
Ethyl 5-chloro-1,3,4-thiadiazole-2-carboxylate is utilized in materials science for the synthesis of novel materials with specific properties. Its incorporation into polymers and other materials can lead to advancements in areas such as electronics, coatings, and adhesives.
Used in Organic Synthesis:
As a versatile building block in organic synthesis, Ethyl 5-chloro-1,3,4-thiadiazole-2-carboxylate is employed in the preparation of various organic compounds. Its reactivity and functional groups make it a valuable component in the synthesis of complex molecules for research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 64837-49-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,8,3 and 7 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 64837-49:
(7*6)+(6*4)+(5*8)+(4*3)+(3*7)+(2*4)+(1*9)=156
156 % 10 = 6
So 64837-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H5ClN2O2S/c1-2-10-4(9)3-7-8-5(6)11-3/h2H2,1H3
64837-49-6Relevant academic research and scientific papers
Aryl hetero ring-substituted aromatic compound (by machine translation)
-
Paragraph 0225-0226, (2020/09/17)
[Problem] β - lactamase inhibiting action in a new compound. (1A) or (1b) or a compound represented by the formula [a] to pharmaceutically acceptable salts. [(1A) (1b) and in the formula, g is, O, etc. S; X is, a hydroxyl group, an alkoxy group such as C1
COMPOUNDS THAT MODULATE EGFR ACTIVITY AND METHODS FOR TREATING OR PREVENTING CONDITIONS THEREWITH
-
Page/Page column 96, (2011/07/09)
Provided are compounds and methods for treating or preventing kinase-mediated disorders therewith.
