65173-82-2 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
1,3,2-Diazaphospholidine, 2-diethylamino-1,3-dimethylis utilized as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure and properties allow for the creation of novel compounds with specific therapeutic or pesticidal effects, contributing to the development of new drugs and crop protection agents.
Used in Organic Material Production:
1,3,2-Diazaphospholidine, 2-diethylamino-1,3-dimethylis employed as a crucial component in the production of various organic materials. Its ability to form stable complexes with metal ions makes it suitable for use in the synthesis of advanced materials with tailored properties for specific applications.
Used as a Catalyst in Chemical Reactions:
1,3,2-Diazaphospholidine, 2-diethylamino-1,3-dimethylhas been studied for its potential use as a catalyst in chemical reactions. Its ability to stabilize reactive intermediates and facilitate specific reaction pathways can enhance the efficiency and selectivity of various chemical processes.
Used in Organometallic Chemistry:
As a ligand in organometallic chemistry, 1,3,2-Diazaphospholidine, 2-diethylamino-1,3-dimethylplays a significant role in the development of new catalysts and coordination compounds. Its unique electronic and steric properties enable the fine-tuning of the reactivity and selectivity of organometallic complexes, leading to innovative applications in homogeneous catalysis and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 65173-82-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,1,7 and 3 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 65173-82:
(7*6)+(6*5)+(5*1)+(4*7)+(3*3)+(2*8)+(1*2)=132
132 % 10 = 2
So 65173-82-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H20N3P/c1-5-11(6-2)12-9(3)7-8-10(12)4/h5-8H2,1-4H3
65173-82-2Relevant academic research and scientific papers
Effect of amino substituents on the stereochemical outcome of the photo-arbuzov rearrangements of 1-arylethyl phosphorodiamidites
Bhanthumnavin, Worawan,Bentrude, Wesley G.
, p. 4643 - 4651 (2007/10/03)
The essentially stereochemically pure 1-arylethyl phosphorodiamidites 8 and 9 were irradiated by UV light in acetonitrile, benzene, and cyclohexane (Tables 1-4). Reaction via singlet free-radical pairs, formed by carbon-oxygen bond scission (Scheme 1), wh
