65351-69-1 Usage
Uses
Used in Pharmaceutical Research and Development:
Heptanoic acid, 7-hydroxy-, hydrazide is used as a building block in the synthesis of various complex organic molecules and pharmaceutical intermediates. Its unique properties and reactivity make it suitable for the development of new drugs and therapeutic agents.
Used in Chemical Research and Development:
Heptanoic acid, 7-hydroxy-, hydrazide is used as a valuable compound for further exploration in chemical research and development. Its diverse range of applications and potential for the synthesis of new compounds make it an important tool in the advancement of chemical sciences.
Used in Drug Discovery and Development:
Heptanoic acid, 7-hydroxy-, hydrazide is used as a promising compound for drug discovery and development due to its potential biological activity and therapeutic potential. Its unique properties and reactivity make it a valuable candidate for the development of new drugs and therapeutic agents in various industries, including pharmaceuticals, biotechnology, and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 65351-69-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,3,5 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 65351-69:
(7*6)+(6*5)+(5*3)+(4*5)+(3*1)+(2*6)+(1*9)=131
131 % 10 = 1
So 65351-69-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N2O2/c8-9-7(11)5-3-1-2-4-6-10/h10H,1-6,8H2,(H,9,11)
