65351-69-1 Usage
General Description
Heptanoic acid, 7-hydroxy-, hydrazide is a chemical compound with the molecular formula C7H15NO2. It is a hydrazide derivative of 7-hydroxyheptanoic acid, which is a fatty acid. Heptanoic acid, 7-hydroxy-, hydrazide has potential use in pharmaceutical and chemical research and development due to its diverse range of applications. Its properties and reactivity make it suitable for use as a building block in the synthesis of various complex organic molecules and pharmaceutical intermediates. Additionally, it may exhibit biological activity and therapeutic potential, making it a valuable compound for further exploration in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 65351-69-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,3,5 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 65351-69:
(7*6)+(6*5)+(5*3)+(4*5)+(3*1)+(2*6)+(1*9)=131
131 % 10 = 1
So 65351-69-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N2O2/c8-9-7(11)5-3-1-2-4-6-10/h10H,1-6,8H2,(H,9,11)
