654-41-1 Usage
Uses
Used in Pharmaceutical Industry:
4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl(9CI) is used as a key intermediate in the synthesis of various pharmaceutical drugs due to its versatile chemical properties and potential therapeutic effects.
Used in Organic Synthesis:
4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl(9CI) is used as a building block in the synthesis of various organic compounds, contributing to the development of new materials and chemical products.
Used in Research and Development:
4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl(9CI) is utilized in research and development for the discovery of new drugs and materials, leveraging its unique structural properties and potential pharmacological activities.
Used in Antiviral Applications:
Due to its antiviral properties, 4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl(9CI) is used as an active pharmaceutical ingredient in the development of antiviral drugs to combat viral infections.
Used in Anti-inflammatory Applications:
Leveraging its anti-inflammatory properties, 4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl- (9CI) is used in the development of drugs to treat various inflammatory conditions.
Used in Antitumor Applications:
4(1H)-Pyrimidinone, 5-fluoro-2,6-dimethyl(9CI) is used in the development of antitumor drugs, targeting cancer cells and potentially contributing to cancer treatment strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 654-41-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 654-41:
(5*6)+(4*5)+(3*4)+(2*4)+(1*1)=71
71 % 10 = 1
So 654-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H7FN2O/c1-3-5(7)6(10)9-4(2)8-3/h1-2H3,(H,8,9,10)
