655-12-9 Usage
Uses
Used in Pharmaceutical Industry:
4'-Chloro-2',5'-difluoroacetophenone is used as a key intermediate for the synthesis of various pharmaceuticals. Its unique halogenated structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4'-Chloro-2',5'-difluoroacetophenone is utilized as an intermediate in the production of agrochemicals, contributing to the development of effective crop protection agents.
Used in Dye Manufacturing:
4'-Chloro-2',5'-difluoroacetophenone is used as a building block in the manufacturing of dyes, enabling the creation of a wide range of colorants for various applications.
Used in Specialty Chemicals Production:
4'-CHLORO-2',5'-DIFLUOROACETOPHENONE is employed in the production of specialty chemicals, where its unique properties are leveraged to create high-value products for niche applications.
Used in Organic Synthesis as a Reagent:
4'-Chloro-2',5'-difluoroacetophenone is used as a reagent in organic synthesis, facilitating various chemical reactions and contributing to the synthesis of complex organic compounds.
Used in Fine Chemicals Production:
As a building block in the production of fine chemicals, 4'-Chloro-2',5'-difluoroacetophenone plays a crucial role in the synthesis of high-purity chemicals used in research and various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 655-12-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 655-12:
(5*6)+(4*5)+(3*5)+(2*1)+(1*2)=69
69 % 10 = 9
So 655-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClF2O/c1-4(12)5-2-8(11)6(9)3-7(5)10/h2-3H,1H3
