65505-16-0

Usage

Uses

Used in Organic Synthesis:
2,5-Dimethyl-3-thiofuroylfuran is utilized as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for multiple points of reactivity, making it a valuable building block in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2,5-Dimethyl-3-thiofuroylfuran is employed as a precursor for the development of new drugs. Its ability to participate in a range of chemical reactions facilitates the synthesis of novel therapeutic agents with potential applications in treating various diseases and conditions.
Used in Agrochemical Industry:
2,5-Dimethyl-3-thiofuroylfuran also finds use in the agrochemical industry, where it serves as a starting material for the synthesis of new pesticides and other agricultural chemicals. Its reactivity and structural features contribute to the development of innovative products designed to enhance crop protection and yield.
Used in Material Science:
Due to its unique structure and properties, 2,5-Dimethyl-3-thiofuroylfuran may have potential uses in the development of new materials. Its incorporation into polymers or other materials could lead to the creation of novel substances with specific properties tailored for various applications in industries such as electronics, textiles, or coatings.
Used in Chemical Reactions:
2,5-Dimethyl-3-thiofuroylfuran is used as a reactant in various chemical reactions, including electrophilic and nucleophilic substitutions, addition reactions, and rearrangements. Its versatility in these processes makes it a valuable tool in the synthesis of a wide array of chemical products.

InChI:InChI=1/C11H9O4S/c1-5-3-7(6(2)14-5)16-8-4-9(16)15-10(8)11(12)13/h3-4H,1-2H3,(H,12,13)/p-1