6571-72-8 Usage
Uses
Used in Chemical Synthesis:
Tetralin is used as a solvent and intermediate in the synthesis of dyes, perfumes, and pharmaceuticals. Its chemical properties allow it to facilitate the production of these complex molecules, making it an essential component in the chemical industry.
Used in Pesticide Production:
Tetralin is employed in the production of insecticides, where it serves as a key ingredient in the formulation of effective pest control products. Its role in this application is crucial for agricultural and horticultural practices to protect crops from pests.
Used in Catalyst Formulation:
As a hydrogenation catalyst, tetralin plays a vital role in various chemical reactions, particularly in the hydrogenation process. This application is significant in the production of various chemicals and materials, contributing to the efficiency of industrial processes.
Used in Synthetic Resins and Rubber Manufacturing:
Tetralin is a component in the manufacturing of synthetic resins and rubber, where it contributes to the properties of the final products. Its presence in these materials is essential for achieving desired characteristics such as flexibility, durability, and resistance to environmental factors.
Environmental Considerations:
Tetralin has been identified as a potential environmental pollutant, and its improper handling can lead to harmful effects on human health and the environment. It is considered harmful if inhaled or ingested, with potential long-term health effects. Therefore, proper handling and disposal of tetralin are crucial to minimize its impact on the environment and human health.
Check Digit Verification of cas no
The CAS Registry Mumber 6571-72-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,7 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6571-72:
(6*6)+(5*5)+(4*7)+(3*1)+(2*7)+(1*2)=108
108 % 10 = 8
So 6571-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H12/c1-2-4-9-6-11-7-10(11)5-8(9)3-1/h1-4,10-11H,5-7H2
6571-72-8Relevant academic research and scientific papers
High temperature bromination. Part 22: Bromination of 1a,2,7,7a-tetrahydro-1H-cyclopropa[b]naphthalene
Demirci-Gültekin, Demet,Günba?, Duygu D.,Ta?kesenligil, Yavuz,Balci, Metin
, p. 8151 - 8156 (2008/02/05)
The high-temperature bromination of 1a,2,7,7a-tetrahydro-1H-cyclopropa[b]naphthalene and its carboethoxy derivative was studied. Reaction of the title compound with 1 mol of bromine in refluxing carbon tetrachloride resulted in the formation of ring-opening products. In the case of the carboethoxy derivative, bromination took place both regio- and stereospecifically at the benzylic positions, the cyclopropane ring did not undergo bond cleavage. A mechanism for the formation of the products and their dehydrobromination reactions is discussed.
