65717-13-7 Usage
General Description
Potassium 1,2,3,6-tetrahydro-5-nitro-2,6-dioxopyrimidine-4-carboxylate is a chemical compound with the molecular formula C6H6N4O6K. It is a potassium salt of a derivative of pyrimidine, a heterocyclic organic compound. Potassium 1,2,3,6-tetrahydro-5-nitro-2,6-dioxopyrimidine-4-carboxylate is commonly used as a food additive and as a preservative in various products. It is also used in the pharmaceutical industry for the production of certain medications. The chemical is known for its antimicrobial properties and is often used to inhibit the growth of bacteria and fungi in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 65717-13-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,7,1 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 65717-13:
(7*6)+(6*5)+(5*7)+(4*1)+(3*7)+(2*1)+(1*3)=137
137 % 10 = 7
So 65717-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H3N3O6.K/c9-3-2(8(13)14)1(4(10)11)6-5(12)7-3;/h(H,10,11)(H2,6,7,9,12);/q;+1/p-1
