65853-65-8 Usage
Uses
Used in Peptide Synthesis:
N-(2-Chlorobenzyloxycarbonyloxy)succinimide is used as a protecting group agent for the side chain of lysine in peptide synthesis. The introduction of the 2-chloro-Z group allows chemists to selectively protect the ε-amino group of lysine, preventing unwanted side reactions during the assembly of peptide chains. This selective protection is crucial for the synthesis of complex peptides with multiple lysine residues, ensuring the correct formation of peptide bonds and the overall integrity of the final product.
Used in Protein Modification:
In the field of protein chemistry, N-(2-Chlorobenzyloxycarbonyloxy)succinimide serves as a valuable tool for the modification of proteins, particularly at their lysine residues. The 2-chloro-Z group can be used to introduce various functional groups or reporter molecules to the protein, enabling the study of protein structure, function, and interactions. Additionally, this reagent can be employed in the development of protein-based drugs, where the selective modification of lysine residues can enhance the stability, solubility, or biological activity of the protein.
Used in Organic Chemistry:
Beyond its applications in peptide and protein chemistry, N-(2-Chlorobenzyloxycarbonyloxy)succinimide is also utilized in organic synthesis for the protection of amines and other nucleophilic functional groups. The 2-chloro-Z group can be used to temporarily mask these reactive sites, allowing for the selective modification of other parts of a molecule. This selective protection is particularly useful in the synthesis of complex organic compounds, where multiple steps and functional group manipulations are required to achieve the desired product.
Check Digit Verification of cas no
The CAS Registry Mumber 65853-65-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,8,5 and 3 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 65853-65:
(7*6)+(6*5)+(5*8)+(4*5)+(3*3)+(2*6)+(1*5)=158
158 % 10 = 8
So 65853-65-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClNO5/c13-9-4-2-1-3-8(9)7-18-12(17)19-14-10(15)5-6-11(14)16/h1-4H,5-7H2
