66256-28-8 Usage
Description
5-Fluoro-2-iodotoluene, with the molecular formula C7H6FIN, is a halogenated aromatic compound characterized by the presence of both a fluorine and an iodine atom attached to a toluene ring. This unique structure endows it with specific chemical properties that make it valuable in various applications.
Uses
Used in Pharmaceutical Industry:
5-Fluoro-2-iodotoluene is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique halogenated structure allows for the creation of complex organic molecules that can be tailored for specific therapeutic applications, such as the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Fluoro-2-iodotoluene serves as an intermediate in the production of various agrochemicals. Its incorporation into these compounds can enhance their pesticidal or herbicidal properties, contributing to more effective crop protection and increased agricultural productivity.
Used in Organic Compounds Synthesis:
5-Fluoro-2-iodotoluene is also employed in the synthesis of other organic compounds, where its halogenated nature can be exploited to create novel materials with specific properties. This can include the development of new polymers, dyes, or other specialty chemicals that have unique applications in various industries.
Used in Chemical Research and Development:
5-FLUORO-2-IODOTOLUENE plays a significant role in research and development within the chemical industry. It is used in the exploration of new chemical reactions and processes, as well as in the study of the properties of halogenated aromatic compounds. This research can lead to advancements in chemical synthesis techniques and the discovery of new applications for 5-fluoro-2-iodotoluene.
Check Digit Verification of cas no
The CAS Registry Mumber 66256-28-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,2,5 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 66256-28:
(7*6)+(6*6)+(5*2)+(4*5)+(3*6)+(2*2)+(1*8)=138
138 % 10 = 8
So 66256-28-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3
