66353-69-3 Usage
Description
[3-amino-4-(methylamino)phenyl] phenyl ketone is an organic compound that serves as an intermediate in the synthesis of various pharmaceutical compounds. It is characterized by the presence of an amino group at the 3-position and a methylamino group at the 4-position on a phenyl ring, which is connected to another phenyl ring through a ketone linkage.
Uses
Used in Pharmaceutical Industry:
[3-amino-4-(methylamino)phenyl] phenyl ketone is used as an intermediate in the synthesis of 1-Methyl Mebendazole (M320150), a related compound with anthelmintic properties. It plays a crucial role in the development of new anthelmintic agents, which are essential for treating infections caused by parasitic worms.
Additionally, it is used in the synthesis of Mebendazole USP Related Compound D, which is another anthelmintic agent. [3-amino-4-(methylamino)phenyl] phenyl ketone is valuable in the pharmaceutical industry for its potential applications in treating various helminthic infections and improving the overall health of affected individuals.
Check Digit Verification of cas no
The CAS Registry Mumber 66353-69-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,3,5 and 3 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 66353-69:
(7*6)+(6*6)+(5*3)+(4*5)+(3*3)+(2*6)+(1*9)=143
143 % 10 = 3
So 66353-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O/c1-16-13-8-7-11(9-12(13)15)14(17)10-5-3-2-4-6-10/h2-9,16H,15H2,1H3
