66373-25-9 Usage
Uses
Used in Scientific Research:
5-Acetyl-2-amino-4-methylpyrimidine is used as a research chemical in the fields of organic chemistry and biochemistry. Its unique molecular structure makes it a valuable compound for studying various chemical reactions and interactions, as well as for the synthesis of other complex molecules.
Used in Organic Chemistry:
In the field of organic chemistry, 5-Acetyl-2-amino-4-methylpyrimidine is used as a building block or intermediate in the synthesis of more complex organic molecules. Its reactivity and functional groups allow for further chemical modifications, making it a versatile compound for the development of new organic compounds.
Used in Biochemistry:
5-Acetyl-2-amino-4-methylpyrimidine may also be used in biochemistry for studying enzyme mechanisms, ligand binding, or as a potential inhibitor of certain biological processes. Its structure may allow it to interact with biological molecules, providing insights into the molecular basis of various biochemical reactions.
Used in Pharmaceutical Development:
Although not explicitly mentioned in the provided materials, due to its structural features, 5-Acetyl-2-amino-4-methylpyrimidine could potentially be used in the pharmaceutical industry as a starting material for the development of new drugs. Its properties may be exploited to design molecules with specific biological activities, targeting various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 66373-25-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,3,7 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 66373-25:
(7*6)+(6*6)+(5*3)+(4*7)+(3*3)+(2*2)+(1*5)=139
139 % 10 = 9
So 66373-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O/c1-4-6(5(2)11)3-9-7(8)10-4/h3H,1-2H3,(H2,8,9,10)
