6638-40-0 Usage
Uses
Used in Pharmaceutical Research and Development:
(4,6-DIAMINO-PYRIMIDIN-2-YLSULFANYL)-ACETIC ACID is utilized as a building block for the synthesis of novel drugs and active pharmaceutical ingredients. Its versatile chemical properties and the presence of amino and sulfanyl groups make it suitable for the development of new therapeutic agents.
Used in Organic Chemistry:
In the field of organic chemistry, (4,6-DIAMINO-PYRIMIDIN-2-YLSULFANYL)-ACETIC ACID is employed as a potential candidate for the development of new materials and functional molecules. Its unique structure allows for various chemical modifications and applications in the synthesis of complex organic compounds.
Used in Chemical Reactions and Synthesis Processes:
(4,6-DIAMINO-PYRIMIDIN-2-YLSULFANYL)-ACETIC ACID is used as a key intermediate in various chemical reactions and synthesis processes. Its reactivity and functional groups enable it to participate in a wide range of chemical transformations, contributing to the production of diverse chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 6638-40-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6638-40:
(6*6)+(5*6)+(4*3)+(3*8)+(2*4)+(1*0)=110
110 % 10 = 0
So 6638-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4O2S/c7-3-1-4(8)10-6(9-3)13-2-5(11)12/h1H,2H2,(H,11,12)(H4,7,8,9,10)
