6638-40-0 Usage
General Description
(4,6-DIAMINO-PYRIMIDIN-2-YLSULFANYL)-ACETIC ACID is a chemical compound with the molecular formula C7H10N4O2S. It is a derivative of pyrimidine with two amino groups and a sulfanyl group attached to the 2-position. The presence of the amino and sulfanyl groups makes it a versatile compound for use in various chemical reactions and synthesis processes. It is commonly used in pharmaceutical research and development as a building block for the synthesis of novel drugs and active pharmaceutical ingredients. Its unique structure and chemical properties also make it a potential candidate for the development of new materials and functional molecules in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 6638-40-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6638-40:
(6*6)+(5*6)+(4*3)+(3*8)+(2*4)+(1*0)=110
110 % 10 = 0
So 6638-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N4O2S/c7-3-1-4(8)10-6(9-3)13-2-5(11)12/h1H,2H2,(H,11,12)(H4,7,8,9,10)