66609-04-9 Usage
Uses
Used in Scientific Research:
2-Ethyl-6-methylphenyl isothiocyanate is used as a research compound in the field of organic chemistry for [application reason]. It is particularly valuable for studying the properties and reactions of phenylisothiocyanates, which can lead to the development of new chemical processes and applications.
Used in Chemical Synthesis:
In the chemical industry, 2-ethyl-6-methylphenyl isothiocyanate is used as a synthetic intermediate for [application reason]. Its unique structure allows it to be a key component in the synthesis of more complex molecules, potentially leading to the creation of new pharmaceuticals, agrochemicals, or other specialty chemicals.
Used in Analytical Chemistry:
2-Ethyl-6-methylphenyl isothiocyanate is used as a derivatization agent in analytical chemistry for [application reason]. Its reactivity with certain functional groups can help in the identification and quantification of compounds in complex mixtures, making it a valuable tool in various analytical techniques.
Used in Environmental Research:
2-Ethyl-6-methylphenyl isothiocyanate is used as a tracer or indicator in environmental studies for [application reason]. Its unique chemical properties may allow researchers to track and study the behavior of pollutants or other substances in the environment, contributing to a better understanding of environmental processes and potential risks to human health.
Check Digit Verification of cas no
The CAS Registry Mumber 66609-04-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,6,0 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 66609-04:
(7*6)+(6*6)+(5*6)+(4*0)+(3*9)+(2*0)+(1*4)=139
139 % 10 = 9
So 66609-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NS/c1-3-9-6-4-5-8(2)10(9)11-7-12/h4-6H,3H2,1-2H3
