66819-06-5 Usage
Uses
Used in Pharmaceutical Industry:
QUINOLIN-8-YLACETONITRILE is used as an intermediate in the synthesis of various drugs, particularly for the development of antimalarial and antifungal agents. Its role in drug production is essential due to its ability to serve as a building block in the creation of these medicinal compounds.
Used in Agrochemical Industry:
As an intermediate, QUINOLIN-8-YLACETONITRILE is also utilized in the synthesis of agrochemicals, contributing to the development of products that protect crops and enhance agricultural productivity.
Used in Chemical Synthesis:
QUINOLIN-8-YLACETONITRILE is used as a precursor for the synthesis of heterocyclic compounds, which are important in various chemical applications and have diverse structures and properties.
Used in Coordination Chemistry:
QUINOLIN-8-YLACETONITRILE serves as a ligand in coordination chemistry, playing a significant role in the formation and properties of coordination compounds.
Used in Optoelectronic Industry:
With its electron-donating properties, QUINOLIN-8-YLACETONITRILE has potential applications in OLEDs (organic light-emitting diodes) and other optoelectronic devices, where it can enhance the performance and efficiency of these technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 66819-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,8,1 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 66819-06:
(7*6)+(6*6)+(5*8)+(4*1)+(3*9)+(2*0)+(1*6)=155
155 % 10 = 5
So 66819-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2/c12-7-6-10-4-1-3-9-5-2-8-13-11(9)10/h1-5,8H,6H2
