6693-08-9 Usage
Uses
Used in Agrochemical Industry:
2,4,6-Trichloro-5-fluoropyrimidine is used as a pesticide intermediate for the production of herbicides and fungicides. Its chemical reactivity allows for the synthesis of effective compounds that protect crops from pests and diseases, ensuring higher yields and better quality produce.
Used in Pharmaceutical Industry:
TCFP is used as a building block in the synthesis of various pharmaceuticals. Its unique molecular structure contributes to the development of new drugs with potential therapeutic applications. Researchers leverage its reactivity to create novel compounds with improved efficacy and reduced side effects.
Used in Chemical Manufacturing:
2,4,6-Trichloro-5-fluoropyrimidine is used in the manufacturing of other chemicals, where its reactive nature enables the production of a wide range of chemical products. Its versatility as a building block allows for the creation of various compounds with diverse applications in different industries.
Proper handling and disposal methods are essential when working with TCFP to prevent environmental contamination and health risks. As a hazardous substance, strict safety measures and regulations must be followed to ensure the safe use of 2,4,6-trichlor0-5-fluoropyrimidine in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6693-08-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,9 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6693-08:
(6*6)+(5*6)+(4*9)+(3*3)+(2*0)+(1*8)=119
119 % 10 = 9
So 6693-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C4Cl3FN2/c5-2-1(8)3(6)10-4(7)9-2
