67139-22-4 Usage
Uses
Used in Pharmaceutical Industry:
5,6,7,8-Tetrahydroimidazo[1,2-a]pyrimidine is used as a pharmaceutical intermediate for the synthesis of various drugs and medicinal compounds. Its unique structure allows it to serve as a building block in the development of new pharmaceuticals, potentially leading to the discovery of novel treatments for a range of diseases and conditions.
As a pharmaceutical intermediate, 5,6,7,8-Tetrahydroimidazo[1,2-a]pyrimidine plays a crucial role in the synthesis of various drug candidates, enabling chemists to create new and innovative medications with improved efficacy, safety, and selectivity. Its presence in the molecular structure of these compounds can contribute to their biological activity, making it an essential component in the ongoing pursuit of advancements in pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 67139-22-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,1,3 and 9 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 67139-22:
(7*6)+(6*7)+(5*1)+(4*3)+(3*9)+(2*2)+(1*2)=134
134 % 10 = 4
So 67139-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3/c1-2-7-6-8-3-5-9(6)4-1/h3,5H,1-2,4H2,(H,7,8)
67139-22-4Relevant academic research and scientific papers
Synthesis and antibacterial activity of some imidazo[1,2-a[pyrimidine derivatives
Rival,Grassy,Michel
, p. 1170 - 1176 (2007/10/02)
A series of 75 imidazo[1,2-a]pyrimidine derivatives were synthesized. The 'in vitro' antibacterial activity of these compounds and their corresponding α-bromoketones against a variety of gram (+), gram (-) bacteria and Mycobacterium species is reported. Some of the prepared derivatives exhibited potent antimicrobial activity.
