672305-35-0 Usage
Chemical class
Amines
Explanation
16-ETHOXY-3,6,9,12,17-PENTAOXANONADEC-1-YLAMINE belongs to the class of amines, which are organic compounds containing nitrogen atoms with a single bond to carbon and two single bonds to hydrogen or other atoms.
Explanation
The compound has a 17-carbon chain, which is a significant part of its molecular structure.
Explanation
The ethoxy group is an alkoxy functional group consisting of an ethyl group (two carbon atoms) and an oxygen atom, which can influence the compound's solubility and reactivity.
Explanation
Due to its unique structure, 16-ETHOXY-3,6,9,12,17-PENTAOXANONADEC-1-YLAMINE may be used in different industrial applications, such as the synthesis of other organic compounds or as an intermediate in chemical processes.
Explanation
The compound's unique structure and properties may make it a valuable subject for research, particularly in the fields of organic chemistry and materials science.
Explanation
The compound's structure and properties may make it a candidate for further investigation in the development of pharmaceuticals, depending on its bioactivity and pharmacological properties.
Explanation
The specific properties and potential uses of 16-ETHOXY-3,6,9,12,17-PENTAOXANONADEC-1-YLAMINE would depend on additional research and testing to better understand its chemical behavior, stability, and potential interactions with other compounds.
Structure
Long chain 17-carbon
Pentaoxanone ring
Contains five oxygen atoms
Ethoxy group
Contains an ethyl group and an oxygen atom
Industrial applications
Potential use in various industries
Research applications
Potential use in scientific research
Pharmaceutical applications
Potential use in the development of drugs
Further research and testing
Required to determine specific properties and uses
Check Digit Verification of cas no
The CAS Registry Mumber 672305-35-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,2,3,0 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 672305-35:
(8*6)+(7*7)+(6*2)+(5*3)+(4*0)+(3*5)+(2*3)+(1*5)=150
150 % 10 = 0
So 672305-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H35NO6/c1-3-22-16(23-4-2)6-5-8-18-10-12-20-14-15-21-13-11-19-9-7-17/h16H,3-15,17H2,1-2H3
672305-35-0Relevant articles and documents
Hydroxyapatite-targeting multiarm polymers and conjugates made therefrom
-
Page/Page column 57-58, (2015/11/27)
The present invention provides, among other things, polymeric reagents suitable for reaction with biologically active agents to form conjugates, the polymeric reagents comprising one or more polymer chains and a plurality of hydroxyapatite-targeting moiet