67266-37-9 Usage
Uses
Used in Pharmaceutical Industry:
2-(Bromomethyl)-1-naphthonitrile is used as a key intermediate in the synthesis of various pharmaceuticals. Its reactivity and structural features allow for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(Bromomethyl)-1-naphthonitrile serves as a precursor for the production of agrochemicals. Its ability to form complex organic molecules contributes to the creation of effective pesticides and other agricultural chemicals.
Used in Dye and Pigment Manufacturing:
2-(Bromomethyl)-1-naphthonitrile is utilized as a starting material in the synthesis of dyes and pigments. Its chemical properties enable the production of a wide range of colorants used in various industries, including textiles, plastics, and printing inks.
Used in Organic Synthesis:
As a versatile building block, 2-(Bromomethyl)-1-naphthonitrile is used in organic synthesis for the preparation of other complex organic molecules. Its bromomethyl group facilitates various chemical reactions, making it a valuable component in the synthesis of specialty chemicals and advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 67266-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,2,6 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 67266-37:
(7*6)+(6*7)+(5*2)+(4*6)+(3*6)+(2*3)+(1*7)=149
149 % 10 = 9
So 67266-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H8BrN/c13-7-10-6-5-9-3-1-2-4-11(9)12(10)8-14/h1-6H,7H2
