67398-39-4 Usage
Uses
Used in Aerospace Industry:
1,1-Diethyl-2-(1-methylethyl)hydrazine is used as a rocket propellant for its high energy content and reactivity, contributing to the propulsion capabilities of rockets and other space vehicles.
Used in Chemical Industry:
In the chemical industry, 1,1-Diethyl-2-(1-methylethyl)hydrazine is employed as a polymerization catalyst, facilitating the process of polymer formation and enhancing the production of various polymeric materials.
Due to its reactive nature and potential hazards, 1,1-Diethyl-2-(1-methylethyl)hydrazine is used in specialized applications where its unique properties are required, and safety precautions are strictly adhered to.
Check Digit Verification of cas no
The CAS Registry Mumber 67398-39-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,3,9 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 67398-39:
(7*6)+(6*7)+(5*3)+(4*9)+(3*8)+(2*3)+(1*9)=174
174 % 10 = 4
So 67398-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H18N2/c1-5-9(6-2)8-7(3)4/h7-8H,5-6H2,1-4H3
