6746-27-6 Usage
Uses
Used in Pharmaceutical Industry:
5-Methyl-1,3,5-triazinane-2-thione is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with potential antiviral and antifungal properties. Its unique structure allows for the creation of compounds that can target specific biological pathways, offering novel treatment options for various diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Methyl-1,3,5-triazinane-2-thione is utilized as a component in the formulation of pesticides and fungicides. Its incorporation aids in enhancing the effectiveness of these products, providing protection for crops against a range of viral and fungal infections, thereby improving agricultural yields and food security.
Used in Specialty Chemicals:
5-Methyl-1,3,5-triazinane-2-thione is employed as a building block in the production of specialty chemicals, where its unique chemical properties can be leveraged to create compounds with specific applications in various industries, such as coatings, adhesives, and textiles.
Used in Materials Science:
In the field of materials science, 5-Methyl-1,3,5-triazinane-2-thione is used for its potential in the development of advanced materials such as polymers and semiconductors. Its incorporation into these materials can lead to improved properties, such as enhanced stability, reactivity, or electrical conductivity, which are crucial for various technological applications.
Overall, the diverse applications of 5-Methyl-1,3,5-triazinane-2-thione underscore its importance as a versatile chemical compound with broad implications across multiple industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6746-27-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,7,4 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6746-27:
(6*6)+(5*7)+(4*4)+(3*6)+(2*2)+(1*7)=116
116 % 10 = 6
So 6746-27-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H9N3S/c1-7-2-5-4(8)6-3-7/h2-3H2,1H3,(H2,5,6,8)
6746-27-6Relevant academic research and scientific papers
Cyclic thioureas as cumene oxidation inhibitors
Garibov,Rzaeva,Shykhaliev,Kuliev,Farzaliev,Allakhverdiev
body text, p. 707 - 711 (2010/08/21)
Hexahydro-1,3,5-triazine-4-thiones were synthesized by ternary condensation of thiourea with various aldehydes and amines. The products were characterized by IR and NMR spectroscopy, and their inhibiting effect on cumene oxidation was examined.
Synthesis and alkylation of hexahydro-1,3,5-triazine-2-thione derivatives
Lazarev,Ramsh,Ivanenko
, p. 442 - 449 (2007/10/03)
A series of new hexahydro-1,3,5-triazine-2-thione derivatives were prepared by aminomethylation of thiourea with formaldehyde and primary amines; with aniline as amine component, an abnormal aminomethylation product is formed, 5-phenyl-1-phenylaminomethylhexahydro-1,3,5-triazine-2-thione. Alkylation of 5-tert-butylhexahydro-1,3,5-triazine-2-thione with alkyl halides and with methyl and ethyl bromoacetate yields hydrohalides of 2-alkylthio- and 2-alkoxycarbonylmethylthio-5-tert-butyl-3,4,5,6-tetrahydro-1,3,5-triazines, respectively.
