6761-70-2 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Dihydro-1,4-benzodioxine-6-carbonyl chloride is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
2,3-Dihydro-1,4-benzodioxine-6-carbonyl chloride is used as a versatile building block in organic synthesis for the preparation of a wide range of organic compounds, including agrochemicals, dyes, and other specialty chemicals. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules.
As a Hazardous Substance:
2,3-Dihydro-1,4-benzodioxine-6-carbonyl chloride is considered a hazardous substance due to its potential health and environmental risks. It should be handled with care and proper safety measures to minimize exposure and ensure the safety of workers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 6761-70-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,7,6 and 1 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6761-70:
(6*6)+(5*7)+(4*6)+(3*1)+(2*7)+(1*0)=112
112 % 10 = 2
So 6761-70-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClO3/c10-9(11)6-1-2-7-8(5-6)13-4-3-12-7/h1-2,5H,3-4H2
