67676-47-5 Usage
Uses
Given the limited information available, it is challenging to provide a detailed list of applications for 4-(N-Ethyl-N-benzoyl)amino-benzoaldehyde. However, based on its chemical structure and the properties of similar compounds, we can speculate on potential uses in the following areas:
Used in Pharmaceutical Industry:
4-(N-Ethyl-N-benzyl)amino-benzoaldehyde could be used as an intermediate in the synthesis of pharmaceutical compounds, given its amine functional group and benzyl substitution. These features may allow it to be incorporated into the structure of various drugs, potentially contributing to their therapeutic effects.
Used in Chemical Research:
As a complex chemical compound, 4-(N-Ethyl-N-benzyl)amino-benzoaldehyde may serve as a subject of study in chemical research, particularly in the fields of organic chemistry and synthetic chemistry. Researchers may investigate its reactivity, stability, and potential applications in the synthesis of other compounds.
Used in Material Science:
The unique structure of 4-(N-Ethyl-N-benzyl)amino-benzoaldehyde may also make it a candidate for use in material science, where it could be explored for its potential to contribute to the development of new materials with specific properties, such as conductivity, stability, or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 67676-47-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,6,7 and 6 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 67676-47:
(7*6)+(6*7)+(5*6)+(4*7)+(3*6)+(2*4)+(1*7)=175
175 % 10 = 5
So 67676-47-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO/c1-2-17(12-14-6-4-3-5-7-14)16-10-8-15(13-18)9-11-16/h3-11,13H,2,12H2,1H3
