67817-20-3 Usage
Chemical class
Azido sugars These are carbohydrates that contain an azido group (N3) attached to the molecule.
Molecular structure
Complex The compound has a 2-azido-2-deoxyglucopyranosyl moiety with four acetyl groups and a chloride group attached.
Functional groups
Acetyl groups (4) and a chloride group These groups contribute to the reactivity and specificity of the compound.
Application
Carbohydrate chemistry It is commonly used in the field of carbohydrate chemistry for the synthesis and modification of glycoconjugates.
Biological and medical importance
Glycoconjugates These are important in various biological and medical applications, such as cell recognition, signal transduction, and immune response.
Reactivity
High The presence of the azido group and the acetyl and chloride groups make the compound highly reactive.
Specificity
High The compound is known for its high specificity in chemical reactions, making it a valuable reagent.
Glycosylation reagent
Potential It can serve as a glycosylation reagent in the chemical modification of carbohydrates for pharmaceutical purposes.
Carbohydrate-protein interactions
Study The compound is used in the study of carbohydrate-protein interactions, which are crucial for understanding various biological processes.
Synthesis
Modification of glycoconjugates It is used in the synthesis and modification of glycoconjugates, which can have potential applications in drug development and vaccine design.
Check Digit Verification of cas no
The CAS Registry Mumber 67817-20-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,8,1 and 7 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 67817-20:
(7*6)+(6*7)+(5*8)+(4*1)+(3*7)+(2*2)+(1*0)=153
153 % 10 = 3
So 67817-20-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClN3O7/c1-5(17)20-4-8-10(21-6(2)18)11(22-7(3)19)9(15-16-14)12(13)23-8/h8-12H,4H2,1-3H3/t8-,9-,10-,11-,12+/m1/s1