67867-48-5 Usage
Uses
Used in Pharmaceutical Industry:
3-Acetyl-2,7-dimethyl-5H-[1]benzopyrano[2,3-b]pyridin-5-one is used as a potential therapeutic agent for various medical conditions. Its unique structure and properties make it a subject of interest for researchers and scientists looking to explore its potential therapeutic uses.
Used in Drug Development:
In the field of drug development, 3-Acetyl-2,7-dimethyl-5H-[1]benzopyrano[2,3-b]pyridin-5-one is used as a starting material or a key intermediate in the synthesis of new drugs. Its specific structure allows for the development of targeted therapies that can address specific medical needs.
Used in Medicinal Chemistry:
3-Acetyl-2,7-dimethyl-5H-[1]benzopyrano[2,3-b]pyridin-5-one is used as a research tool in medicinal chemistry to understand the structure-activity relationship of various compounds. Its unique properties can provide insights into the design and optimization of new drugs with improved efficacy and safety profiles.
Further studies and experiments are needed to fully understand the properties and potential applications of 3-acetyl-2,7-dimethyl-5H-[1]benzopyrano[2,3-b]pyridin-5-one. As research progresses, it is expected that 3-ACETYL-2,7-DIMETHYL-5 H-[1]BENZOPYRANO[2,3-B]PYRIDIN-5-ONE will play a significant role in the development of novel therapeutic agents and contribute to advancements in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 67867-48-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,8,6 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 67867-48:
(7*6)+(6*7)+(5*8)+(4*6)+(3*7)+(2*4)+(1*8)=185
185 % 10 = 5
So 67867-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO3/c1-8-4-5-14-12(6-8)15(19)13-7-11(10(3)18)9(2)17-16(13)20-14/h4-7H,1-3H3
67867-48-5Relevant academic research and scientific papers
Construction and biological evaluations of some novel chromeno[2,3-b]pyridines and chromeno[2,3-b]- quinolines using 6-methylchromone-3-carbonitrile
Ibrahim, Magdy A.,El-Gohary, Nasser M.
, p. 489 - 505 (2021/03/22)
Reaction of 6-methylchromone-3-carbonitrile (1) with acetylacetone under basic conditions afforded 3-acetyl-2,7-dimethyl-5H-chromeno[2,3-b]- pyridin-5-one (2) which utilized as a starting substrate. Condensation of compound 2 with a variety of amines and
