6817-41-0 Usage
Description
Isoliensinine is a bisisoquinoline alkaloid derived from the embryo of the seeds of Nelumbo nucifera Gaertn, also known as the sacred lotus. It exhibits unique optical rotation properties and is characterized by the presence of three methoxyl, two hydroxyl, and two methylimino groups. Isoliensinine has been found to activate AMP-activated kinase and regulate PPARγ receptors, making it a potential candidate for various therapeutic applications.
Uses
Used in Pharmaceutical Applications:
Isoliensinine is used as a therapeutic agent for its ability to activate AMP-activated kinase and regulate PPARγ receptors. These properties suggest potential applications in the treatment of metabolic disorders and other conditions related to the dysregulation of these cellular pathways.
Used in Drug Development:
Isoliensinine's unique biochemical properties make it a valuable compound for further research and development in the pharmaceutical industry. Its potential to modulate cellular pathways involved in various diseases positions it as a promising candidate for the development of new drugs targeting these pathways.
Used in Metabolic Research:
The activation of AMP-activated kinase and regulation of PPARγ receptors by Isoliensinine make it a valuable tool in metabolic research. It can be used to study the underlying mechanisms of these pathways and their role in metabolic diseases, potentially leading to the discovery of novel therapeutic targets and treatments.
References
Tomita et aI., Tetrahedron Lett., 2637,3374 (1964)
Check Digit Verification of cas no
The CAS Registry Mumber 6817-41-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,8,1 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6817-41:
(6*6)+(5*8)+(4*1)+(3*7)+(2*4)+(1*1)=110
110 % 10 = 0
So 6817-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C37H42N2O6/c1-38-15-13-26-20-36(44-5)37(22-29(26)30(38)16-23-6-9-27(42-3)10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-33(41)34(43-4)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1