68571-74-4 Usage
Uses
Used in Organic Chemistry:
Isoxazolo[5,4-d]pyrimidin-4(5H)-one, 3-methyl(7CI,9CI) is utilized as a building block in organic chemistry for the synthesis of various complex molecules. Its unique structure allows for the creation of novel compounds with potential applications in different fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, Isoxazolo[5,4-d]pyrimidin-4(5H)-one, 3-methyl(7CI,9CI) is employed as an intermediate for the development of new drug candidates. Its incorporation into molecular structures can lead to the discovery of bioactive substances with potential therapeutic applications.
While the specific pharmacological and biological properties of Isoxazolo[5,4-d]pyrimidin-4(5H)-one, 3-methyl(7CI,9CI) are not widely documented, its role as a versatile intermediate in chemical synthesis and drug development highlights its importance in scientific research and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 68571-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,7 and 1 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 68571-74:
(7*6)+(6*8)+(5*5)+(4*7)+(3*1)+(2*7)+(1*4)=164
164 % 10 = 4
So 68571-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3O2/c1-3-4-5(10)7-2-8-6(4)11-9-3/h2,9H,1H3
