688-13-1 Usage
General Description
Glycyl-D-leucine is a dipeptide molecule composed of the amino acid glycine and the D-form of leucine. It is commonly used in pharmaceuticals and research as a model molecule for the study of peptide binding and conformational changes. Glycyl-D-leucine is also known for its potential use in the development of anti-inflammatory drugs, as it has been shown to inhibit the production of pro-inflammatory cytokines. Additionally, this dipeptide has been studied for its potential antioxidant and neuroprotective properties, making it a subject of interest in the field of neurology and neurodegenerative diseases. Overall, Glycyl-D-leucine has a wide range of potential biological activities and applications, making it an important molecule in various scientific and medical research endeavors.
Check Digit Verification of cas no
The CAS Registry Mumber 688-13-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,8 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 688-13:
(5*6)+(4*8)+(3*8)+(2*1)+(1*3)=91
91 % 10 = 1
So 688-13-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2O3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m1/s1
