689-13-4 Usage
Uses
Used in Pharmaceutical Industry:
Hadacidin is used as an anti-cancer agent for its ability to inhibit the proliferation of cells often associated with cancers. It acts as an inhibitor of adenylsuccinate synthetase, a key enzyme involved in the de novo synthesis of AMP, which is crucial for cellular energy metabolism and growth. By targeting this enzyme, hadacidin can potentially disrupt the energy supply and growth of cancer cells, making it a promising candidate for cancer treatment.
Additionally, hadacidin's unique chemical structure may allow for further exploration in drug development, potentially leading to the creation of novel therapeutic agents for various diseases and conditions.
Used in Research and Development:
Hadacidin's unique properties and biological activities make it an interesting compound for research and development purposes. It can be used as a starting point for the synthesis of new molecules with potential applications in various fields, such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 689-13-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,8 and 9 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 689-13:
(5*6)+(4*8)+(3*9)+(2*1)+(1*3)=94
94 % 10 = 4
So 689-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C3H5NO4/c5-2-4(8)1-3(6)7/h2,8H,1H2,(H,6,7)