6954-70-7 Usage
General Description
2,5-dimethyl-4-nitrobenzoic acid is a chemical compound with the molecular formula C9H9NO4. It is a yellow crystalline solid that is commonly used in the pharmaceutical and analytical industries. 2,5-diMethyl-4-nitrobenzoicacid is a derivative of benzoic acid and contains two methyl groups and a nitro group attached to the benzene ring. It is often used as a reagent for the synthesis of various organic compounds and as a standard for analytical techniques such as high-performance liquid chromatography (HPLC). 2,5-dimethyl-4-nitrobenzoic acid also exhibits some potential biological activities and is being studied for its potential applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 6954-70-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,5 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6954-70:
(6*6)+(5*9)+(4*5)+(3*4)+(2*7)+(1*0)=127
127 % 10 = 7
So 6954-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO4/c1-5-4-8(10(13)14)6(2)3-7(5)9(11)12/h3-4H,1-2H3,(H,11,12)