6954-79-6 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-bromoethoxy)-2,4,5-trichlorobenzene is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications, making it a valuable component in the medicinal chemistry field.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(2-bromoethoxy)-2,4,5-trichlorobenzene is utilized as an intermediate for the production of pesticides and other agrochemicals. Its chemical properties enable the creation of compounds that can effectively control pests and diseases in agriculture, thereby contributing to increased crop yields and food security.
Used in Dye Industry:
1-(2-bromoethoxy)-2,4,5-trichlorobenzene is also employed in the dye industry as an intermediate for synthesizing various types of dyes. The presence of the bromoethoxy group and chlorine atoms in its structure allows for the development of dyes with specific color properties and stability, which are essential for various applications in textiles, plastics, and other industries.
Used in Organic Compounds Production:
1-(2-bromoethoxy)-2,4,5-trichlorobenzene serves as an intermediate in the production of a range of organic compounds. Its versatile structure facilitates the synthesis of various organic molecules with different functional groups, which can be further utilized in various chemical and industrial applications.
It is crucial to handle 1-(2-bromoethoxy)-2,4,5-trichlorobenzene with care, as it can pose potential risks to human health and the environment if not managed and disposed of properly. Precautionary measures should be taken to minimize exposure and ensure safe handling, storage, and disposal of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 6954-79-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,5 and 4 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6954-79:
(6*6)+(5*9)+(4*5)+(3*4)+(2*7)+(1*9)=136
136 % 10 = 6
So 6954-79-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrCl3O/c9-1-2-13-8-4-6(11)5(10)3-7(8)12/h3-4H,1-2H2
6954-79-6Relevant academic research and scientific papers
Phenoxypropoxybiguanides, prodrugs of DHFR-inhibiting diaminotriazine antimalarials
Jensen,Ager,Bliss,Canfield,Kotecka,Rieckmann,Terpinski,Jacobus
, p. 3925 - 3931 (2007/10/03)
A total of 34 analogues of the biguanide PS-15 (5s), a prodrug of the diaminotriazine WR-99210 (8s), have been prepared. Several of them, such as 5b (PS-33) and 5m (PS-26), maintain or exceed the in vivo activity of PS-15 while not requiring the use of highly regulated starting materials. The putative diaminotriazine metabolites of these new analogues (compounds 8) have also been prepared and shown to maintain the activity against resistant P. falciparum strains. The structure-activity relationships of biguanides 5 and putative metabolites 8 are discussed.
