69945-52-4 Usage
Uses
Used in Medicinal Chemistry and Drug Development:
2,4-Diamino-5-(4-nitrobenzyl)pyrimidine is used as a chemical compound with potential biological activities due to its structural features. Its presence of amino and nitrobenzyl groups may contribute to its interactions with biological targets, making it a promising candidate for the development of new drugs and therapeutic agents.
Used in Chemical and Pharmaceutical Sciences Research:
2,4-Diamino-5-(4-nitrobenzyl)pyrimidine is used as a building block for the synthesis of other organic compounds. Its unique structure and properties make it a valuable component in the development of novel chemical entities and pharmaceuticals. Researchers and pharmaceutical companies in the field of chemical and pharmaceutical sciences are interested in exploring its potential applications and further understanding its properties.
Check Digit Verification of cas no
The CAS Registry Mumber 69945-52-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,4 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 69945-52:
(7*6)+(6*9)+(5*9)+(4*4)+(3*5)+(2*5)+(1*2)=184
184 % 10 = 4
So 69945-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N5O2/c12-10-8(6-14-11(13)15-10)5-7-1-3-9(4-2-7)16(17)18/h1-4,6H,5H2,(H4,12,13,14,15)
