69945-52-4 Usage
General Description
2,4-Diamino-5-(4-nitrobenzyl)pyrimidine is a chemical compound with the molecular formula C11H11N5O2. It is a pyrimidine derivative that contains two amino groups and a nitrobenzyl group. 2,4-Diamino-5-(4-nitrobenzyl)pyrimidine has potential applications in medicinal chemistry and drug development, as it may have biological activities due to its structural features. Additionally, it can be used as a building block for the synthesis of other organic compounds. Its properties and potential uses make it a subject of interest for researchers and pharmaceutical companies in the field of chemical and pharmaceutical sciences.
Check Digit Verification of cas no
The CAS Registry Mumber 69945-52-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,4 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 69945-52:
(7*6)+(6*9)+(5*9)+(4*4)+(3*5)+(2*5)+(1*2)=184
184 % 10 = 4
So 69945-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N5O2/c12-10-8(6-14-11(13)15-10)5-7-1-3-9(4-2-7)16(17)18/h1-4,6H,5H2,(H4,12,13,14,15)